This compound is a protected amino acid derivative used in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino group and a benzyl group on the cysteine side chain, making it suitable for solid-phase peptide assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 5068-28-0
N-alpha-t-Butyloxycarbonyl-S-(4-methyl-benzyl)-L-cysteine
research reagent for peptide synthesis
Z-TYR(TBU)-OME
Protected amino acid intermediate
Bis(4-nitrophenyl) carbonate
pharmaceutical intermediate
6-Isopropylchromone-3-carbonitrile
pharmaceutical intermediate
Methyl 3-methoxy-4-nitrobenzoate
pharmaceutical intermediate
(2R)-3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
IFVORPLRHYROAA-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O