Pyridine-2,4-dicarboxylic acid is a pyridinedicarboxylic acid with carboxy groups at positions 2 and 4. It is primarily significant as a research reagent used in enzyme inhibition studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 499-80-9
Pyridine-3,5-dicarboxylic acid
research compound for coordination chemistry
Guanidine hydrochloride
Laboratory chemical research reagent
Coumalic acid
research compound
3,5-Dimethoxyphenol
chemical standard and research compound
pyridine-2,4-dicarboxylic acid
MJIVRKPEXXHNJT-UHFFFAOYSA-N
C1=CN=C(C=C1C(=O)O)C(=O)O