4,4',4''-Trimethoxytrityl chloride is a chemical compound used as a protecting group reagent for alcohols in organic synthesis. It features a trityl core with three methoxy substituents, providing stability and selectivity for protecting hydroxyl groups during complex molecule assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 49757-42-8
P-(Chlorodiphenylmethyl)anisole
Pharmaceutical intermediate for oligonucleotide synthesis
1,1'-(Chlorophenylmethylene)bis(4-methoxybenzene)
protecting group reagent
Tritylchlorid
Protecting group reagent for alcohols
Tert-Butyl 1H-imidazole-1-carboxylate
synthetic intermediate for Boc protection
Nipecotic acid
GABA reuptake inhibitor
4-Hydroxy-3-methylbenzoic acid
human blood serum metabolite research
Pyridine-2,4-dicarboxylic acid
enzyme inhibitor research compound
1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene
OBFCMKPFILBCSQ-UHFFFAOYSA-N
COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)(C3=CC=C(C=C3)OC)Cl
—