4-Chloromandelic acid is a chemical compound featuring a chlorophenyl group and a hydroxyacetic acid moiety. It serves as a pharmaceutical intermediate used in the synthesis of various active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 492-86-4
Phenyl N-phenylcarbamate
Pharmaceutical intermediate
1-Adamantaneacetic acid
pharmaceutical intermediate
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
Hippuric acid
Pharmaceutical intermediate for synthesis
2-(4-chlorophenyl)-2-hydroxyacetic acid
BWSFWXSSALIZAU-UHFFFAOYSA-N
C1=CC(=CC=C1C(C(=O)O)O)Cl