1-Adamantaneacetic acid is a chemical compound that serves as a pharmaceutical intermediate. It is commonly used in the manufacturing of various pharmaceutical products.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4942-47-6
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
Hippuric acid
Pharmaceutical intermediate for synthesis
Methyl 1-t-butoxycarbonyl-4-trifluoromethylpiperidine-4-carboxylate
pharmaceutical intermediate
4-amino-5-methoxy-N,2-dimethylbenzenesulfonamide
pharmaceutical intermediate
2-(1-adamantyl)acetic acid
AOTQGWFNFTVXNQ-UHFFFAOYSA-N
C1C2CC3CC1CC(C2)(C3)CC(=O)O