Biphenyl-2-boronic acid is a boronic acid reagent commonly used in organic synthesis. It consists of two aromatic rings with a boronic acid functional group, making it suitable for Suzuki-type coupling reactions.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4688-76-0
[2-(3-phenylphenyl)phenyl]boronic acid
Electronic chemical intermediate
(2,4-dimethylphenyl)boronic Acid
Boronic acid reagent for synthesis
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
Thiophene-3-boronic acid
Boronic acid reagent for synthesis
1-Kestose
reference standard for fructooligosaccharides
5-Bromothiophene-2-carbaldehyde
research compound
Tris(3-hydroxypropyl)phosphine
reductant for vitamin K epoxide reductase assay
(2-phenylphenyl)boronic acid
HYCYKHYFIWHGEX-UHFFFAOYSA-N
B(C1=CC=CC=C1C2=CC=CC=C2)(O)O