3,4,5-Trimethoxybenzoyl chloride is a chemical compound used as a pharmaceutical intermediate in the synthesis of phenethylamine derivatives, including mescaline. It features an aromatic ring substituted with three methoxy groups and an acyl chloride group.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 4521-61-3
2,5-Dimethoxybenzaldehyde
Pharmaceutical intermediate for phenethylamine synthesis
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
(5R)-5-(2,2-Dimethyl-4H-1,3-benzodioxin-6-yl)-1,3-oxazolidin-2-one
pharmaceutical intermediate
4-Fluoro-3-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
3,4,5-trimethoxybenzoyl chloride
BUHYMJLFRZAFBF-UHFFFAOYSA-N
COC1=CC(=CC(=C1OC)OC)C(=O)Cl