4-Fluoro-3-nitrobenzoic acid is a chemical compound used primarily as a pharmaceutical intermediate. It features an aromatic ring substituted with fluorine and nitro groups, along with a carboxylic acid functional group, contributing to its polarity and reactivity in synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 453-71-4
3-Fluoro-4-nitrobenzoic acid
pharmaceutical intermediate
Boc-glycine
amino acid protecting reagent
[3,3'-Bifuran]-2,2',5,5'-tetrone, tetrahydro-
Pharmaceutical intermediate
3-hydroxyazetidine
pharmaceutical intermediate
3-Amino-5-fluorobenzotrifluoride
pharmaceutical intermediate
4-fluoro-3-nitrobenzoic acid
BOJWTAQWPVBIPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])F