2,4,5-Trifluorobenzoic acid is a fluorinated aromatic carboxylic acid used as a research compound. Its crystal structures have been studied to understand the structural landscape of benzoic acid derivatives.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 446-17-3
4-Chloro-2-fluorobenzoic acid
research compound
2-Amino-4-fluorobenzoic acid
research compound
5-FLUORO-2-NITROPHENOL
research compound
3-Fluoro-4-nitroanisole
research compound
2,4,5-trifluorobenzoic acid
AKAMNXFLKYKFOJ-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)F)C(=O)O