5-Fluoro-2-nitrophenol is a fluorinated aromatic compound containing both a nitro group and a hydroxyl group on a benzene ring. It is primarily used as a research reagent in laboratory settings for the synthesis of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 446-36-6
3-Fluoro-4-nitroanisole
research compound
2-Fluorobenzyl bromide
Research reagent for organic synthesis
Benzenemethanol, 2-fluoro-
organic synthesis building block
2-Fluorophenylmagnesium bromide
organometallic reagent for synthesis
5-fluoro-2-nitrophenol
QQURWFRNETXFTN-UHFFFAOYSA-N
C1=CC(=C(C=C1F)O)[N+](=O)[O-]