2,2,6,6-d4-Morpholine is a deuterated form of morpholine used as an analytical standard. Its incorporation of four deuterium atoms makes it valuable for quantitative analysis and internal standardization in mass spectrometry and nuclear magnetic resonance spectroscopy.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 35530-94-0
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
N-DODECANE-D26
deuterated standard for analytical chemistry
Quinolin-5-ylboronic Acid
Research reagent for Suzuki coupling
5-bromonicotinonitrile
research compound
Benzyl bromide-d7
deuterated research standard
5-Iodo-4-methylpyridin-2-amine
Research compound
Morpholin
Solvent and chemical intermediate
Morpholine-d8 Hydrochloride
deuterated solvent reference standard
2,2,6,6-tetradeuteriomorpholine
YNAVUWVOSKDBBP-KHORGVISSA-N
[2H]C1(CNCC(O1)([2H])[2H])[2H]