N-DODECANE-D26 is a fully deuterated form of dodecane, where all 26 hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry, particularly in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to improve accuracy in quantitative analysis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 16416-30-1
N-tetracosane-d50
isotopically labeled research standard
(2H18)Octane
Deuterated NMR solvent and internal standard
N-decane-d22
deuterated alkane reference standard
N-HEXANE-D14
Deuterated solvent for analytical chemistry
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
2-methylphenyl boronic acid
research compound
Methyl 5-bromo-1H-pyrrole-3-carboxylate
Research compound for chemical synthesis
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane
SNRUBQQJIBEYMU-DWXHPOBZSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]