2-Fluoro-3-methoxyphenylboronic acid is a boronic acid derivative used as a pharmaceutical intermediate. It is primarily supplied for use in the synthesis of active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 352303-67-4
(2-amino-1,3-benzothiazol-6-yl)acetonitrile
Pharmaceutical intermediate synthesis
3-(4-chlorophenyl)pentanedioic acid
Pharmaceutical intermediate
1,1,1-Trifluoro-2-iodoethane
pharmaceutical intermediate
4-(2-Aminoethyl)benzenesulfonamide
Pharmaceutical intermediate for API synthesis
(2-fluoro-3-methoxyphenyl)boronic acid
JCKZNMSBFBPDPM-UHFFFAOYSA-N
B(C1=C(C(=CC=C1)OC)F)(O)O