3-(4-chlorophenyl)pentanedioic acid is a chemical compound used as a pharmaceutical intermediate. It contains a chlorinated aromatic ring and two carboxylic acid groups, making it a building block in the synthesis of various medicinal agents.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 35271-74-0
(S)-Baclofen
active pharmaceutical ingredient
(R)-Baclofen
active pharmaceutical ingredient
Baclofen
active pharmaceutical ingredient
1,1,1-Trifluoro-2-iodoethane
pharmaceutical intermediate
4-(2-Aminoethyl)benzenesulfonamide
Pharmaceutical intermediate for API synthesis
4-Aminopyridine 1-oxide
pharmaceutical intermediate
2-(3-Oxobutanamido)benzoic acid
Pharmaceutical intermediate for peptide synthesis
3-(4-chlorophenyl)pentanedioic acid
URXVLIVRJJNJII-UHFFFAOYSA-N
C1=CC(=CC=C1C(CC(=O)O)CC(=O)O)Cl