This compound is a research reagent with a complex heterocyclic structure incorporating halogen atoms and a difluoromethoxy group. It is primarily of interest for laboratory-scale studies and chemical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 3039517-14-8
2-Piperidinoethanol
Research compound for synthetic chemistry
D-Arabinoic acid sodium salt
sodium salt of arabinoic acid
3-Aminophenylboronic acid
research compound
8-Methyl-7H-purin-6-ol
research compound
(1R,3R)-1-[2-bromo-6-(difluoromethoxy)phenyl]-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
Research compound
(1R)-1-[2-bromo-6-(difluoromethoxy)phenyl]-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
RWHDLZYBIPZZOG-JLOHTSLTSA-N
C1[C@@H](N2C3=C(C=CC(=C3)Cl)N=C2C1N)C4=C(C=CC=C4Br)OC(F)F
—