Diacetamate is a chemical compound that serves as a pharmaceutical intermediate. It is primarily used in the manufacturing process of acetaminophen, a common analgesic and antipyretic.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2623-33-8
2-iodo-4-methoxypyrimidine
pharmaceutical intermediate
N-(4-aminophenyl)-N-methyl-2-(4-methylpiperazin-1-yl)acetamide
pharmaceutical intermediate
2,4-dichloronicotinic acid
Pharmaceutical intermediate for synthesis
(2S)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(4-acetamidophenyl) acetate
UJAOSPFULOFZRR-UHFFFAOYSA-N
CC(=O)NC1=CC=C(C=C1)OC(=O)C