This compound is a protected proline derivative used as an intermediate in peptide synthesis. Its structure features a tert-butoxycarbonyl (Boc) protecting group on the nitrogen and a free carboxylic acid, making it valuable for solid-phase and solution-phase peptide assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 26250-84-0
(2R)-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid for peptide synthesis
Boc-L-proline
Protected amino acid for peptide synthesis
(S)-(-)-1-Phenylethylamine
Chiral resolution intermediate
3-Iodooxetane
pharmaceutical intermediate
(2S)-1-amino-1-oxo-3-((3S)-2-oxopyrrolidin-3-yl)propan-2-aminium chloride
pharmaceutical intermediate
2-Amino-2,3-dimethylbutanoic acid
Pharmaceutical intermediate for amino acid derivatives
(2R)-1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid
JQAOHGMPAAWWQO-QMMMGPOBSA-N
CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)O