This compound is a hydrochloride salt of S-tert-butyl-L-cysteine, a derivative of the amino acid cysteine. It is primarily used as a research reagent in laboratory settings, particularly in studies involving modified amino acids for peptide synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2481-09-6
Trimethyl orthopropionate
chemical reagent and intermediate
FMOC-PRO-THR(PSI(ME,ME)PRO)-OH
research compound for peptide synthesis
(2S)-2,6-Bis({[(Tert-Butoxy)Carbonyl]Amino})Hexanoic Acid
protected lysine derivative for peptide synthesis
D-Allothreonine
D-alpha-amino acid standard
(2R)-2-amino-3-tert-butylsulfanylpropanoic acid;hydrochloride
MHBMYFJKEBCMDR-JEDNCBNOSA-N
CC(C)(C)SC[C@@H](C(=O)O)N.Cl