2,2'-Dithiodipyridine is a chemical compound consisting of two pyridine rings linked by a disulfide bond. It serves as an oxidizing agent in molecular biology research, commonly used to activate thiol groups or form disulfide bonds in biomolecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2127-03-9
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
2-(pyridin-2-yldisulfanyl)pyridine
HAXFWIACAGNFHA-UHFFFAOYSA-N
C1=CC=NC(=C1)SSC2=CC=CC=N2