This compound is a research reagent featuring a chloromethyl-substituted phenoxyethyl group attached to an azepane ring. It is primarily used as a building block in organic synthesis for the preparation of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 212771-30-7
1-(2-(4-(chloromethyl)phenoxy)ethyl)azepane hydrochloride
pharmaceutical intermediate
Pyridine-2-carboximidamide hydrochloride
Research compound for chemical synthesis
S-Ethylisothiourea hydrobromide
Research compound for chemical synthesis
2-Nitro-1-phenylpropane
Research compound for chemical synthesis
2-Amino-3,5-dibromopyrazine
Research compound for chemical synthesis
(E)-methyl 4-(dimethylamino)but-2-enoate
research compound
2,3-Difluoro-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
1-[2-[4-(chloromethyl)phenoxy]ethyl]azepane
FGCIQSBZGOVNLI-UHFFFAOYSA-N
C1CCCN(CC1)CCOC2=CC=C(C=C2)CCl
—