This compound is a perfluorinated ether acid fluoride intermediate, characterized by a highly fluorinated ether backbone and an acyl fluoride group. It is primarily used in industrial chemical processes as a building block for specialized fluorinated materials.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2062-98-8
P-carborane
boron cluster compound precursor
4-Butylbenzoic acid
Building block for organic synthesis
2,5-Dicyanopyridine
chemical intermediate for synthesis
2-Bromo-2-methylpropionyl bromide
Fine and large scale chemical synthesis
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride
BCLQALQSEBVVAD-UHFFFAOYSA-N
C(=O)(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)F