p-Carborane is a boron cluster compound characterized by a cage-like molecular structure. It serves as a precursor in the synthesis of other boron-rich compounds for research and industrial applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 20644-12-6
1,7-Dicarbadodecaborane(12)
boron cluster chemistry building block
4-Butylbenzoic acid
Building block for organic synthesis
2,5-Dicyanopyridine
chemical intermediate for synthesis
2-Bromo-2-methylpropionyl bromide
Fine and large scale chemical synthesis
Nickel bis(trifluoromethylsulfonyl)imide
Electrolyte material for batteries
CFNUZRMHHJZBOM-UHFFFAOYSA-N
[B]1[B][B][B]C2[B][B]C([B]2)[B][B][B]1