Adenosine-(1)N N1-oxide is a nitrogen-15 labeled research compound derived from adenosine, featuring an N-oxide modification at the N1 position of the purine ring. It is primarily used as a reference standard or tracer in analytical and biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 197227-85-3
1-Methyladenosine
research compound
6-Nitroindoline
Caged neurotransmitter precursor research compound
Z-Thr-OH
research compound
3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrosophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Nitrosamine impurity reference standard
2-Methyl-4-nitrobenzoic acid
research compound
(2R,3R,4S,5R)-2-(6-(15N)azanylidene-1-hydroxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
QHFLZHVITNUFMV-ZGUONDJVSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=CN(C2=[15NH])O