6-Chloro-2-methyl-2H-indazol-5-amine is a chemical compound used as a pharmaceutical intermediate. It features a substituted indazole ring system with an amino group and a chlorine atom, contributing to its utility in the synthesis of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1893125-36-4
Tert-Butyl (4S)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate
Pharmaceutical intermediate
Tert-Butyl (4R)-3,3-difluoro-4-hydroxypiperidine-1-carboxylate
Pharmaceutical intermediate
Ethyl (2R,3S)-2-(4-(cyclopentylamino)phenyl)piperidine-3-carboxylate bis((2R,3R)-2,3-bis((4-methylbenzoyl)oxy)succinate)
pharmaceutical intermediate for anticoagulants
Boc-Tyr-OtBu
Pharmaceutical intermediate for peptide synthesis
6-chloro-2-methylindazol-5-amine
YRZNRFJEBAPCCO-UHFFFAOYSA-N
CN1C=C2C=C(C(=CC2=N1)Cl)N