Boc-Tyr-OtBu is a protected derivative of the amino acid tyrosine, commonly used as a building block in peptide synthesis. Its structure incorporates tert-butoxycarbonyl (Boc) and tert-butyl ester (OtBu) protecting groups, making it suitable for solid-phase or solution-phase peptide assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 18938-60-8
Boc-Tyr-OMe
Peptide synthesis intermediate
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-
Protected amino acid for peptide synthesis
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
Sodium chlorodifluoroacetate
Pharmaceutical intermediate for synthesis
(S)-2-Methyl-1-(6-nitropyridin-3-yl)piperazine
pharmaceutical intermediate
18-(benzyloxy)-18-oxooctadecanoic acid
Pharmaceutical intermediate for synthesis
tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
WGJGINMQCMATNP-AWEZNQCLSA-N
CC(C)(C)OC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)OC(C)(C)C