Tris(1,3-dichlorisopropyl)phosphat
TDCPP (tris(1,3-dichloroisopropyl)phosphate) is a chlorinated organophosphate compound primarily used as a flame retardant in polyurethane foams. It is structurally related to other chlorinated flame retardants such as TCEP and TCPP.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13674-87-8
1,1'-(Methylenedi-p-phenylene)bismaleimide
intermediate for polymer synthesis
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
tris(1,3-dichloropropan-2-yl) phosphate
ASLWPAWFJZFCKF-UHFFFAOYSA-N
C(C(CCl)OP(=O)(OC(CCl)CCl)OC(CCl)CCl)Cl