2,2,3,3,4,4,4-Heptafluorobutyl methacrylate is a fluorinated monomer used in polymer synthesis. It features an ester functional group and multiple fluorine atoms, contributing to the properties of the resulting polymers.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13695-31-3
2-[(Pentafluoropropanoyl)oxy]ethyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
Copper dimethyldithiocarbamate
Elastomer accelerator for rubber vulcanization
2-METHYL-1-BUTANOL
Solvent and chemical intermediate
2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate
VIEHKBXCWMMOOU-UHFFFAOYSA-N
CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F