2-chloro-4-(dihydroxyboranyl)benzoic acid is a chemical compound containing a boronic acid group and a carboxylic acid group on an aromatic ring. It is a boronic acid derivative of chlorobenzoic acid, commonly used as a building block in organic synthesis and medicinal chemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 136496-72-5
4-borono-2-chlorobenzoic acid
QFAFGWXQNDYXPZ-UHFFFAOYSA-N
B(C1=CC(=C(C=C1)C(=O)O)Cl)(O)O