3-Phenylisoserine, (2R,3S)- is a stereochemically defined amino acid derivative featuring an aromatic ring, a hydroxyl group, and an amine group. It is primarily encountered as a research compound and building block in chemical synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 136561-53-0
(2R,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid
RZARFIRJROUVLM-JGVFFNPUSA-N
C1=CC=C(C=C1)[C@@H]([C@H](C(=O)O)O)N