This compound is an organic salt, specifically the hydrobromide form of a brominated pyridine derivative. It is primarily encountered as a research reagent used in chemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1338000-32-0
(6-Bromopyridin-2-yl)(1-methylpiperidin-4-yl)methanone
research compound
2-(Diethylamino)-6-methyl-1H-pyrimidin-4-one
Research reagent for chemical studies
1,2-dicervonoylglycerol
lipid research standard
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
2-Cyanoethyl (6-(2,2,2-trifluoroacetamido)hexyl) diisopropylphosphoramidite
solid-phase oligonucleotide synthesis reagent
2-oxaspiro[3.3]heptan-6-one
research reagent
(6-Aminopyridin-2-yl)(1-methylpiperidin-4-yl)methanone
pharmaceutical intermediate
6-(1-methylpiperidine-4-carbonyl)pyridin-2-amine dihydrochloride
Research compound
(6-bromo-2-pyridinyl)-(1-methylpiperidin-4-yl)methanone;hydrobromide
UINYIZJEJDKZEY-UHFFFAOYSA-N
CN1CCC(CC1)C(=O)C2=NC(=CC=C2)Br.Br