1,2-dicervonoylglycerol is a long-chain diglyceride used as a research standard in lipid studies. Its structure features two docosahexaenoic acid chains esterified to a glycerol backbone, contributing to its high molecular weight and flexibility.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 133831-25-1
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
2-Cyanoethyl (6-(2,2,2-trifluoroacetamido)hexyl) diisopropylphosphoramidite
solid-phase oligonucleotide synthesis reagent
2-oxaspiro[3.3]heptan-6-one
research reagent
Benzil
organic synthesis reagent
[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-hydroxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
XIAZEYRSKHAPND-GZSOIYOPSA-N
CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(CO)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC