(R)-Propionyl Carnitine-d3 Chloride is a deuterium-labeled research compound, structurally characterized as a quaternary ammonium salt with a carboxylic acid and ester functional group. It is primarily used as a stable isotope-labeled reagent for analytical and laboratory research applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1334532-19-2
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Octanoyl L-Carnitine-d3 Chloride
isotopically labeled research standard
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Levocarnitine propionate hydrochloride
pharmaceutical raw material
[(2R)-3-carboxy-2-propanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride
KTFMPDDJYRFWQE-WVKKGGDISA-N
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CC.[Cl-]