Octanoyl L-Carnitine-d3 Chloride is an isotopically labeled research standard, deuterated at the methyl group attached to the quaternary nitrogen. It is a salt form of the L-carnitine ester with octanoic acid, used primarily as a reference compound in analytical chemistry and metabolic studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1334532-24-9
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Stearoyl-L-carnitine-d3 (chloride)
stable isotope labeled reference standard
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
N-tetracosane-d50
isotopically labeled research standard
1,2,3-trichloropropane (d5)
isotopically labeled research standard
DL-MEVALONOLACTONE-4,4,5,5-D4
isotopically labeled research standard
(113C)ethane
isotopically labeled research standard
[(2R)-3-carboxy-2-octanoyloxypropyl]-dimethyl-(trideuteriomethyl)azanium chloride
MYMFUYYXIJGKKU-HZUATLIXSA-N
[2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCCCCC.[Cl-]
—