Tetrabenzyl-voglibose is a polybenzylated derivative of voglibose, used as a pharmaceutical intermediate in the synthesis of the alpha-glucosidase inhibitor voglibose. It contains multiple ether and alcohol functional groups and is characterized by a complex stereochemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 115250-39-0
2-(4-aminophenyl)-2-methylpropanenitrile
pharmaceutical intermediate
Glycidyl 3-nitrobenzenesulfonate
Pharmaceutical intermediate
Benzenesulfonic acid, 3-nitro-, (2R)-2-oxiranylmethyl ester
Pharmaceutical intermediate for synthesis
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethylsulfonyloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
pharmaceutical intermediate
2-[[(1S,2S,3R,4S,5S)-5-hydroxy-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]amino]propane-1,3-diol
DYSHUNINHUTCLX-ILOBPARPSA-N
C1[C@@H]([C@@H]([C@H]([C@@H]([C@]1(COCC2=CC=CC=C2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)NC(CO)CO