Magnesium nitrate is an inorganic compound that exists as a white solid, commonly encountered as the hexahydrate form. It is primarily significant for its use as a catalyst and in pyrotechnic compositions due to its oxidizing properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 10377-60-3
SODIUM NITRATE
Explosives, fertilizers, photographic processing
Kaliumnitrat
Pesticide active ingredient
Europium Nitrate Hexahydrate
rare earth metal intermediate
Bismuth nitrate pentahydrate
synthesis of other bismuth compounds
Palladium nitrate
Catalyst for chemical reactions
Zinc nitrate hexahydrate
Mordant in dyeing
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate
chelating agent
Tri-p-tolylphosphine
Ligand for transition metal catalysis
magnesium dinitrate
YIXJRHPUWRPCBB-UHFFFAOYSA-N
[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mg+2]