Isophthaloyl chloride is a chemical compound primarily used as an intermediate in the production of dyes and synthetic fibers. It features a benzene ring with two acid chloride functional groups, making it reactive in polymer and dye synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 99-63-8
3-Chlorobenzoyl chloride
Pharmaceutical intermediate
1,3-Dinitrobenzene
intermediate for dyes and explosives
Irganox 565
Antioxidant stabilizing agent
1,1,1,2,3,3-hexafluoro-3-(2,2,2-trifluoroethoxy)propane
Fluorinated solvent or intermediate
(3-methyloxetan-3-yl)methyl 4-methylbenzenesulfonate
benzenesulfonate ester intermediate
benzene-1,3-dicarbonyl chloride
FDQSRULYDNDXQB-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl