4-Bromobenzenesulfonyl chloride is a chemical compound commonly employed as a reagent in organic synthesis. It features an aromatic ring substituted with both a bromine atom and a sulfonyl chloride group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 98-58-8
2-Ethylhexyl chloroformate
Reagent for organic synthesis
4-Methoxybenzenesulfonyl chloride
Sulfonyl chloride reagent for synthesis
4-tert-Butylbenzoic acid
alkyd resin modifier and corrosion inhibitor
Piperidinium piperidine-1-carbodithioate
rubber accelerator
CUMENE
Production of phenol and acetone
4-bromobenzenesulfonyl chloride
KMMHZIBWCXYAAH-UHFFFAOYSA-N
C1=CC(=CC=C1S(=O)(=O)Cl)Br