Ethyl chrysanthemate is an ester compound that functions as a monoterpenoid. It is primarily used as an intermediate in the production of synthetic pyrethroid insecticides.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 97-41-6
(4S)-4-(2-Chlorophenyl)-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphinane 2-oxide
herbicide intermediate
1,3,2-Dioxaphosphorinane, 4-(2-chlorophenyl)-2-hydroxy-5,5-dimethyl-, 2-oxide, (4R)-
Organophosphorus fungicide or pesticide
Ethanone, 2,2-dichloro-1-(2,3-dihydro-3-methyl-4H-1,4-benzoxazin-4-yl)-
herbicide safener
2,6-DICHLORO-4-NITROANILINE
Selective agricultural fungicide
ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
VIMXTGUGWLAOFZ-UHFFFAOYSA-N
CCOC(=O)C1C(C1(C)C)C=C(C)C