2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride is a research compound featuring a dichlorophenyl ring and a fluorine-substituted ethanamine group. Its structure includes an amine functional group and multiple halogens, and it is supplied as a hydrochloride salt for laboratory use.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 960053-41-2
(4-Aminophenyl)boronic acid hydrate
Research reagent for boronic acid chemistry
Propan-2-yl prop-2-ynoate
research compound
2'-deoxyguanosine
research compound for oxidative stress studies
2,4,6-Tri-tert-butylaniline
research compound
2-(2,4-dichlorophenyl)-2-fluoroethanamine;hydrochloride
PBEKPQSMDQIZFJ-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)Cl)C(CN)F.Cl
—