This compound is the hydrochloride salt of 2-ethylbutyl (2S)-2-aminopropanoate, a chiral amino acid ester. It serves as an intermediate in the production of the antiviral compound remdesivir.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 946511-97-3
Ethyl 2-[4-(Boc-amino)cyclohexyl]acetate
Pharmaceutical intermediate with Boc-protected amine
2,3,4,5-Tetrafluorobenzoyl chloride
Pharmaceutical intermediate for synthesis
Ethyl 3-oxo-(2,3,4,5-tetrafluorophenyl)propanoate
Pharmaceutical intermediate for synthesis
2,2-Diphenylacetaldehyde
pharmaceutical intermediate synthesis
2-ethylbutyl (2S)-2-aminopropanoate;hydrochloride
DEAGOVGXNPHPIJ-FJXQXJEOSA-N
CCC(CC)COC(=O)[C@H](C)N.Cl