This compound is a fluorinated methacrylate monomer, specifically this compound. It is used as a research reagent in polymer chemistry for the synthesis of fluorinated polymers with specialized properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 944480-10-8
2-[2-(2-Propynyloxy)ethoxy]ethylamine
Click chemistry building block
6-BROMO-2,3-DIHYDRO-3-BENZOFURANAMINE
research compound
4-[[[(6S)-2-Amino-5-formyl-3,4,5,6,7,8-hexahydro-4-oxo-6-pteridinyl]methyl]amino]benzoic acid
research compound
D-Phenylalanyl Nateglinide
research compound
[4,4,4-trifluoro-3-hydroxy-2-methyl-3-(trifluoromethyl)butan-2-yl] 2-methylprop-2-enoate
BKUNBDQVOHMIAE-UHFFFAOYSA-N
CC(=C)C(=O)OC(C)(C)C(C(F)(F)F)(C(F)(F)F)O
—