p,p'-DDT-d8 is a deuterium-labeled analog of the organochlorine compound DDT, specifically used as a reference standard in analytical chemistry. Its primary significance lies in providing a stable isotope-labeled internal standard for the quantification of DDT residues in environmental and biological samples.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 93952-18-2
Phenethyl Alcohol-d5
reference standard for analytical chemistry
Phenol-2,3,4,5,6-d5
reference standard for analytical chemistry
P,p'-DDD-d8
isotopically labeled research compound
3,3',4,4'-TETRACHLOROBIPHENYL-D6
isotopically labeled research compound
Pyrazine-2,6-dicarboxylic Acid
research compound
P-Toluenesulfonyl azide
Synthetic reagent for diazo transfer
1-Chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)ethyl]benzene
insecticide and pesticide
1-chloro-2,3,5,6-tetradeuterio-4-[2,2,2-trichloro-1-(4-chloro-2,3,5,6-tetradeuteriophenyl)ethyl]benzene
YVGGHNCTFXOJCH-PGRXLJNUSA-N
[2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])C(Cl)(Cl)Cl)[2H])[2H])Cl)[2H]