Benzo[k]fluoranthene-d12 is a deuterated analytical reference standard used in research and laboratory settings. It is the isotopically labeled form of benzo[k]fluoranthene, with all twelve hydrogen atoms replaced by deuterium, facilitating precise quantification in analytical chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 93952-01-3
Fluoranthene-d10, 98 atom % D
deuterated research standard
Dibenzo[b,d]furan-d8
deuterated analytical standard
Propane-1,1,1,2,3,3-d6, 2,3-dichloro-
deuterated research standard
Di-n-butyl phthalate-d4
research compound
1,2-Benzene-3,4,5,6-d4-dicarboxylic acid, diethyl ester
deuterated analytical reference standard
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[k]fluoranthene
HAXBIWFMXWRORI-AQZSQYOVSA-N
[2H]C1=C(C(=C2C(=C3C4=C(C(=C(C5=C4C(=C(C(=C5[2H])[2H])[2H])C3=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]