Benzyl Butyl Phthalate-d4 is a deuterated analytical standard, where four hydrogen atoms on the benzene ring are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry for the quantification of benzyl butyl phthalate in environmental or biological samples.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 93951-88-3
2,4,4'-Trimethyldiphenylamine
chemical intermediate
4-AMINO-5-AMINOMETHYL-2-METHYLPYRIMIDINE
precursor for thiamine biosynthesis
(4S,5S)-4-Isopropyl-2,2,5-trimethyl-1,3-dioxolane-4-carboxylic acid
pharmaceutical reference standard
SOMAN
Chemical warfare nerve agent
Benzyl Salicylate-d4
Deuterated research reagent
Benzil benzoat
scabicide and insect repellent
BENZYL 4-HYDROXYBENZOATE-2,3,5,6-D4
deuterated research compound
4-(Benzyloxycarbonyl)phenylboronic acid
pharmaceutical intermediate for API synthesis
2-O-benzyl 1-O-butyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
IRIAEXORFWYRCZ-CXRURWBMSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCCCC)C(=O)OCC2=CC=CC=C2)[2H])[2H]