Bis-2-ethylhexyl phthalate d4 is a deuterium-labeled derivative of the industrial chemical bis(2-ethylhexyl) phthalate, used primarily as a phthalate plasticizer. Its structure features a fully deuterated aromatic ring with two ester groups, contributing to its high flexibility and non-polar character.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 93951-87-2
Dioctyl phthalate-3,4,5,6-d4
Phthalate plasticizer research reference standard
2-bromo-1-phenylnaphthalene
chemical intermediate for organic synthesis
2-Hydroxyethyl benzoate
industrial intermediate for specialty chemicals
BENZOYL PEROXIDE
Polymerization catalyst and bleaching agent
Bis(2-ethylhexyl) phthalate
plasticizer for polymer materials
bis(2-ethylhexyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate
BJQHLKABXJIVAM-SAQXESPHSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC)[2H])[2H]