This compound is a Boc-protected amino acid derivative featuring a naphthyl-substituted D-glycine backbone. It is primarily used as an intermediate in the synthesis of peptides and other complex organic molecules in pharmaceutical research and manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 93779-36-3
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl]amino}pent-4-enoic acid
Boc-protected amino acid intermediate
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
2,4,6-Trimethylbenzoyl chloride
Pharmaceutical intermediate
2-amino-2-(4-hydroxyphenyl)acetic acid
Pharmaceutical intermediate for antibiotic synthesis
3-Morpholino-1-(2-thienyl)propan-1-one hydrochloride
Pharmaceutical intermediate for cloperastine
Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt
nucleotide triphosphate intermediate
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-naphthalen-2-ylacetic acid
MQCLXWDVGKUKHB-CQSZACIVSA-N
CC(C)(C)OC(=O)N[C@H](C1=CC2=CC=CC=C2C=C1)C(=O)O
—