This compound is an industrial chemical used as a UV absorber in personal care products. Its structure incorporates an aromatic benzotriazole ring and a sulfonate group, which contribute to its ability to absorb ultraviolet light.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 92484-48-5
Diethyl 2,2'-thiodiacetate
chemical intermediate for thioester synthesis
Sebacic acid dihydrazide
crosslinking agent for polymers
Propane, 2-(ethenyloxy)-2-methyl-
Vinyl ether monomer
Tert-Butyl peroxypivalate
polymerization initiator
2-(2H-Benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol
UV absorber additive
2-(2'-hydroxy-5'-methacryloxyethylphenyl)-2h-benzotriazole
UV absorber intermediate
2,4-Di-tert-butyl-6-(5-chloro-2H-benzotriazol-2-yl)phenol
UV absorber for plastics
Tinuvin
UV stabilizer for plastics
sodium 3-(benzotriazol-2-yl)-5-butan-2-yl-4-hydroxybenzenesulfonate
XTXADMXOEMEPAC-UHFFFAOYSA-M
CCC(C)C1=C(C(=CC(=C1)S(=O)(=O)[O-])N2N=C3C=CC=CC3=N2)O.[Na+]