2,4-Dimethoxybenzoic acid is a research compound with a structure featuring an aromatic ring substituted by two methoxy groups and a carboxylic acid group. Its crystalline structure has been characterized in crystallographic studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 91-52-1
2',4'-Dimethoxyacetophenone
Research compound and chemical intermediate
3,3'-Diaminobenzidine
Peroxidase histochemical reagent
3-[N-Tris-(hydroxymethyl)methylamino]propanesulphonic acid, sodium salt
biological buffer research reagent
N-(2-Picolinoylphenyl)benzamide
research compound
Potassium (tert-butoxymethyl)trifluoroborate
organoboron reagent for cross-coupling
2,4-dimethoxybenzoic acid
GPVDHNVGGIAOQT-UHFFFAOYSA-N
COC1=CC(=C(C=C1)C(=O)O)OC