Benzhydryl chloride is a chlorinated organic compound consisting of a diphenylmethyl structure with a chlorine atom attached to the central carbon. It is primarily used as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 90-99-3
4-Chlorobenzhydryl chloride
Pharmaceutical intermediate for synthesis
Ethyl ((1R,3aR,4aR,6R,8aR,9S,9aS)-9-(diphenylcarbamoyl)-1-methyl-3-oxododecahydronaphtho[2,3-c]furan-6-yl)carbamate
pharmaceutical intermediate
(3R,3aR,4S,4aR,7R,8aR,9aR)-7-((Ethoxycarbonyl)amino)-3-methyl-1-oxododecahydronaphtho[2,3-c]furan-4-carboxylic acid
Pharmaceutical intermediate
2-[4,5-diethoxy-2-(ethoxymethyl)-6-methoxyoxan-3-yl]oxy-6-(hydroxymethyl)-5-methoxyoxane-3,4-diol
pharmaceutical excipient and coating agent
Ethylene glycol monostearate
surfactant and emulsifier in pharmaceuticals
[chloro(phenyl)methyl]benzene
ZDVDCDLBOLSVGM-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)Cl