BippyPhos is a bipyrazole ligand used in research as a reagent for coordination chemistry and catalysis. Its structure features a phosphine group attached to a bipyrazole core with multiple aromatic rings, contributing to its role in organometallic studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 894086-00-1
(2-hydroxyphenyl)boronic Acid
chemical building block for boronic acid reactions
6-bromo-2-methoxypyridin-3-amine
research reagent
2-Bromo-4-methoxypyridine
Research reagent
1-cyclohexenylboronic Acid
research compound
ditert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane
PTXJGGGNGMPMBG-UHFFFAOYSA-N
CC(C)(C)P(C1=CC=NN1C2=C(N(N=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C(C)(C)C